C16H18NO6P — CID 54294496
[4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]anilino]phosphonic acid (PubChem CID 54294496) has the molecular formula C16H18NO6P and a molecular weight of 351.30 g/mol. Its IUPAC name is [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]anilino]phosphonic acid.
| Compound Name | [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]anilino]phosphonic acid |
|---|---|
| PubChem CID | 54294496 |
| Molecular Formula | C16H18NO6P |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]anilino]phosphonic acid |
| SMILES | CC(CC(=O)c1cc(O)ccc1NP(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H18NO6P/c1-10(11-3-2-4-12(18)8-11)7-16(20)14-9-13(19)5-6-15(14)17-24(21,22)23/h2-6,8-10,18-19H,7H2,1H3,(H3,17,21,22,23) |
| InChIKey | RZVMAHYABRACND-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|