About 3-(1-hydroxyethyl)phenol;methanesulfonic acid
3-(1-hydroxyethyl)phenol;methanesulfonic acid (PubChem CID 174877430) has the molecular formula C9H14O5S
and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)phenol;methanesulfonic acid.
Molecular Properties
| Compound Name | 3-(1-hydroxyethyl)phenol;methanesulfonic acid |
| PubChem CID | 174877430 |
| Molecular Formula | C9H14O5S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(1-hydroxyethyl)phenol;methanesulfonic acid |
| SMILES | CC(O)c1cccc(O)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C8H10O2.CH4O3S/c1-6(9)7-3-2-4-8(10)5-7;1-5(2,3)4/h2-6,9-10H,1H3;1H3,(H,2,3,4) |
| InChIKey | LYEVJXMJZGLNKL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hydroxyethyl)phenol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The IUPAC name of 3-(1-hydroxyethyl)phenol;methanesulfonic acid (CID 174877430) is 3-(1-hydroxyethyl)phenol;methanesulfonic acid.
What is the SMILES notation for 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The canonical SMILES for 3-(1-hydroxyethyl)phenol;methanesulfonic acid is CC(O)c1cccc(O)c1.CS(=O)(=O)O.
What is the InChIKey of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The InChIKey is LYEVJXMJZGLNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.CH4O3S/c1-6(9)7-3-2-4-8(10)5-7;1-5(2,3)4/h2-6,9-10H,1H3;1H3,(H,2,3,4).
What are the key properties of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
3-(1-hydroxyethyl)phenol;methanesulfonic acid has a molecular weight of 234.27 g/mol, XLogP of 0.95, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxyethyl)phenol;methanesulfonic acid is sourced from PubChem (CID 174877430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).