3-(1-hydroxyethyl)phenol;methanesulfonic acid

C9H14O5S — CID 174877430

IUPAC3-(1-hydroxyethyl)phenol;methanesulfonic acid
SMILESCC(O)c1cccc(O)c1.CS(=O)(=O)O
InChIInChI=1S/C8H10O2.CH4O3S/c1-6(9)7-3-2-4-8(10)5-7;1-5(2,3)4/h2-6,9-10H,1H3;1H3,(H,2,3,4)
InChIKeyLYEVJXMJZGLNKL-UHFFFAOYSA-N
MW234.27 g/mol
LogP0.95
Rot. Bonds1

About 3-(1-hydroxyethyl)phenol;methanesulfonic acid

3-(1-hydroxyethyl)phenol;methanesulfonic acid (PubChem CID 174877430) has the molecular formula C9H14O5S and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)phenol;methanesulfonic acid.

Molecular Properties

Compound Name3-(1-hydroxyethyl)phenol;methanesulfonic acid
PubChem CID174877430
Molecular FormulaC9H14O5S
Molecular Weight234.27 g/mol
Exact Mass234.06
IUPAC Name3-(1-hydroxyethyl)phenol;methanesulfonic acid
SMILESCC(O)c1cccc(O)c1.CS(=O)(=O)O
InChIInChI=1S/C8H10O2.CH4O3S/c1-6(9)7-3-2-4-8(10)5-7;1-5(2,3)4/h2-6,9-10H,1H3;1H3,(H,2,3,4)
InChIKeyLYEVJXMJZGLNKL-UHFFFAOYSA-N
XLogP0.95
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.27
LogP ≤ 50.95
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(1-hydroxyethyl)phenol;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The IUPAC name of 3-(1-hydroxyethyl)phenol;methanesulfonic acid (CID 174877430) is 3-(1-hydroxyethyl)phenol;methanesulfonic acid.
What is the SMILES notation for 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The canonical SMILES for 3-(1-hydroxyethyl)phenol;methanesulfonic acid is CC(O)c1cccc(O)c1.CS(=O)(=O)O.
What is the InChIKey of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
The InChIKey is LYEVJXMJZGLNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.CH4O3S/c1-6(9)7-3-2-4-8(10)5-7;1-5(2,3)4/h2-6,9-10H,1H3;1H3,(H,2,3,4).
What are the key properties of 3-(1-hydroxyethyl)phenol;methanesulfonic acid?
3-(1-hydroxyethyl)phenol;methanesulfonic acid has a molecular weight of 234.27 g/mol, XLogP of 0.95, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxyethyl)phenol;methanesulfonic acid is sourced from PubChem (CID 174877430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).