C15H19NO2 — CID 70466970
3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;benzene (PubChem CID 70466970) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;benzene.
| Compound Name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;benzene |
|---|---|
| PubChem CID | 70466970 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;benzene |
| SMILES | C[C@H](N)[C@H](O)c1cccc(O)c1.c1ccccc1 |
| InChI | InChI=1S/C9H13NO2.C6H6/c1-6(10)9(12)7-3-2-4-8(11)5-7;1-2-4-6-5-3-1/h2-6,9,11-12H,10H2,1H3;1-6H/t6-,9-;/m0./s1 |
| InChIKey | ZWXXPWYGHOBZPU-YDYUUSCQSA-N |
| XLogP | 2.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |