C9H11NO4 — CID 131629270
3-[(1S,2S)-1-hydroxy-2-nitropropyl]phenol (PubChem CID 131629270) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-[(1S,2S)-1-hydroxy-2-nitropropyl]phenol.
| Compound Name | 3-[(1S,2S)-1-hydroxy-2-nitropropyl]phenol |
|---|---|
| PubChem CID | 131629270 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-[(1S,2S)-1-hydroxy-2-nitropropyl]phenol |
| SMILES | C[C@@H]([C@@H](O)c1cccc(O)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C9H11NO4/c1-6(10(13)14)9(12)7-3-2-4-8(11)5-7/h2-6,9,11-12H,1H3/t6-,9+/m0/s1 |
| InChIKey | YKJVNSQPZQAZHC-IMTBSYHQSA-N |
| XLogP | 1.09 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|