C10H13NO4 — CID 46854012
(1R,2S)-2-methyl-1-(3-nitrophenyl)propane-1,3-diol (PubChem CID 46854012) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (1R,2S)-2-methyl-1-(3-nitrophenyl)propane-1,3-diol.
| Compound Name | (1R,2S)-2-methyl-1-(3-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 46854012 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (1R,2S)-2-methyl-1-(3-nitrophenyl)propane-1,3-diol |
| SMILES | C[C@@H](CO)[C@@H](O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13NO4/c1-7(6-12)10(13)8-3-2-4-9(5-8)11(14)15/h2-5,7,10,12-13H,6H2,1H3/t7-,10+/m0/s1 |
| InChIKey | WERBRWILELUBTA-OIBJUYFYSA-N |
| XLogP | 1.26 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|