C11H14ClNO5 — CID 102192421
(1S,2R)-2-(2-chloroethoxy)-1-(3-nitrophenyl)propane-1,3-diol (PubChem CID 102192421) has the molecular formula C11H14ClNO5 and a molecular weight of 275.69 g/mol. Its IUPAC name is (1S,2R)-2-(2-chloroethoxy)-1-(3-nitrophenyl)propane-1,3-diol.
| Compound Name | (1S,2R)-2-(2-chloroethoxy)-1-(3-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 102192421 |
| Molecular Formula | C11H14ClNO5 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (1S,2R)-2-(2-chloroethoxy)-1-(3-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1cccc([C@H](O)[C@@H](CO)OCCCl)c1 |
| InChI | InChI=1S/C11H14ClNO5/c12-4-5-18-10(7-14)11(15)8-2-1-3-9(6-8)13(16)17/h1-3,6,10-11,14-15H,4-5,7H2/t10-,11+/m1/s1 |
| InChIKey | ZAIOCXJFGUJGBI-MNOVXSKESA-N |
| XLogP | 1.24 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|