C8H6Cl3NO3 — CID 6922856
(1R)-2,2,2-trichloro-1-(3-nitrophenyl)ethanol (PubChem CID 6922856) has the molecular formula C8H6Cl3NO3 and a molecular weight of 270.50 g/mol. Its IUPAC name is (1R)-2,2,2-trichloro-1-(3-nitrophenyl)ethanol.
| Compound Name | (1R)-2,2,2-trichloro-1-(3-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 6922856 |
| Molecular Formula | C8H6Cl3NO3 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | (1R)-2,2,2-trichloro-1-(3-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1cccc([C@@H](O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C8H6Cl3NO3/c9-8(10,11)7(13)5-2-1-3-6(4-5)12(14)15/h1-4,7,13H/t7-/m1/s1 |
| InChIKey | QTPMEWPNYWDGID-SSDOTTSWSA-N |
| XLogP | 3.00 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|