C9H8F3NO3 — CID 125489284
(1R)-3,3,3-trifluoro-1-(3-nitrophenyl)propan-1-ol (PubChem CID 125489284) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is (1R)-3,3,3-trifluoro-1-(3-nitrophenyl)propan-1-ol.
| Compound Name | (1R)-3,3,3-trifluoro-1-(3-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 125489284 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (1R)-3,3,3-trifluoro-1-(3-nitrophenyl)propan-1-ol |
| SMILES | O=[N+]([O-])c1cccc([C@H](O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F3NO3/c10-9(11,12)5-8(14)6-2-1-3-7(4-6)13(15)16/h1-4,8,14H,5H2/t8-/m1/s1 |
| InChIKey | BGMPOHGPMWRNQA-MRVPVSSYSA-N |
| XLogP | 2.58 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|