C10H11NO5 — CID 102374268
(4R)-1,4-dihydroxy-4-(3-nitrophenyl)butan-2-one (PubChem CID 102374268) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is (4R)-1,4-dihydroxy-4-(3-nitrophenyl)butan-2-one.
| Compound Name | (4R)-1,4-dihydroxy-4-(3-nitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 102374268 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4R)-1,4-dihydroxy-4-(3-nitrophenyl)butan-2-one |
| SMILES | O=C(CO)C[C@@H](O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11NO5/c12-6-9(13)5-10(14)7-2-1-3-8(4-7)11(15)16/h1-4,10,12,14H,5-6H2/t10-/m1/s1 |
| InChIKey | GJYCXCMSLAAOCX-SNVBAGLBSA-N |
| XLogP | 0.58 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|