C15H22BNO5 — CID 122229243
1-(3-nitrophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol (PubChem CID 122229243) has the molecular formula C15H22BNO5 and a molecular weight of 307.16 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol.
| Compound Name | 1-(3-nitrophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 122229243 |
| Molecular Formula | C15H22BNO5 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(3-nitrophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
| SMILES | CC(B1OC(C)(C)C(C)(C)O1)C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22BNO5/c1-10(16-21-14(2,3)15(4,5)22-16)13(18)11-7-6-8-12(9-11)17(19)20/h6-10,13,18H,1-5H3 |
| InChIKey | GXUGVZSYPCUPBM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|