About 3-(2-nitropropyl)phenol
3-(2-nitropropyl)phenol (PubChem CID 55250663) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(2-nitropropyl)phenol.
Molecular Properties
| Compound Name | 3-(2-nitropropyl)phenol |
| PubChem CID | 55250663 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-(2-nitropropyl)phenol |
| SMILES | CC(Cc1cccc(O)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C9H11NO3/c1-7(10(12)13)5-8-3-2-4-9(11)6-8/h2-4,6-7,11H,5H2,1H3 |
| InChIKey | PNTCNZJSLNJHPS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-nitropropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-nitropropyl)phenol?
The IUPAC name of 3-(2-nitropropyl)phenol (CID 55250663) is 3-(2-nitropropyl)phenol.
What is the SMILES notation for 3-(2-nitropropyl)phenol?
The canonical SMILES for 3-(2-nitropropyl)phenol is CC(Cc1cccc(O)c1)[N+](=O)[O-].
What is the InChIKey of 3-(2-nitropropyl)phenol?
The InChIKey is PNTCNZJSLNJHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-7(10(12)13)5-8-3-2-4-9(11)6-8/h2-4,6-7,11H,5H2,1H3.
What are the key properties of 3-(2-nitropropyl)phenol?
3-(2-nitropropyl)phenol has a molecular weight of 181.19 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-nitropropyl)phenol is sourced from PubChem (CID 55250663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).