C9H12ClNO — CID 28743755
(1S,2S)-2-amino-1-(3-chlorophenyl)propan-1-ol (PubChem CID 28743755) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-(3-chlorophenyl)propan-1-ol.
| Compound Name | (1S,2S)-2-amino-1-(3-chlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 28743755 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (1S,2S)-2-amino-1-(3-chlorophenyl)propan-1-ol |
| SMILES | C[C@H](N)[C@@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H12ClNO/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-6,9,12H,11H2,1H3/t6-,9+/m0/s1 |
| InChIKey | OYGPLKFNQHPTBG-IMTBSYHQSA-N |
| XLogP | 1.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |