C16H17O6P — CID 57153076
[4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]phosphonic acid (PubChem CID 57153076) has the molecular formula C16H17O6P and a molecular weight of 336.28 g/mol. Its IUPAC name is [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]phosphonic acid.
| Compound Name | [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 57153076 |
| Molecular Formula | C16H17O6P |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [4-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]phosphonic acid |
| SMILES | CC(CC(=O)c1cc(O)ccc1P(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H17O6P/c1-10(11-3-2-4-12(17)8-11)7-15(19)14-9-13(18)5-6-16(14)23(20,21)22/h2-6,8-10,17-18H,7H2,1H3,(H2,20,21,22) |
| InChIKey | YLCINTSGWOEBCH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|