C16H19O7P — CID 57291625
[2-[1,1-dihydroxy-2-(3-hydroxyphenyl)butyl]-5-hydroxyphenyl]phosphonic acid (PubChem CID 57291625) has the molecular formula C16H19O7P and a molecular weight of 354.30 g/mol. Its IUPAC name is [2-[1,1-dihydroxy-2-(3-hydroxyphenyl)butyl]-5-hydroxyphenyl]phosphonic acid.
| Compound Name | [2-[1,1-dihydroxy-2-(3-hydroxyphenyl)butyl]-5-hydroxyphenyl]phosphonic acid |
|---|---|
| PubChem CID | 57291625 |
| Molecular Formula | C16H19O7P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [2-[1,1-dihydroxy-2-(3-hydroxyphenyl)butyl]-5-hydroxyphenyl]phosphonic acid |
| SMILES | CCC(c1cccc(O)c1)C(O)(O)c1ccc(O)cc1P(=O)(O)O |
| InChI | InChI=1S/C16H19O7P/c1-2-13(10-4-3-5-11(17)8-10)16(19,20)14-7-6-12(18)9-15(14)24(21,22)23/h3-9,13,17-20H,2H2,1H3,(H2,21,22,23) |
| InChIKey | DTKQNTZLRDGMQC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|