About [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate
[2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate (PubChem CID 22673484) has the molecular formula C16H19O8P
and a molecular weight of 370.29 g/mol. Its IUPAC name is [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate |
| PubChem CID | 22673484 |
| Molecular Formula | C16H19O8P |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCC(c1ccc(O)cc1)C(O)(O)c1c(O)cccc1OP(=O)(O)O |
| InChI | InChI=1S/C16H19O8P/c1-2-12(10-6-8-11(17)9-7-10)16(19,20)15-13(18)4-3-5-14(15)24-25(21,22)23/h3-9,12,17-20H,2H2,1H3,(H2,21,22,23) |
| InChIKey | APRPEKSZBFWZJU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate?
The IUPAC name of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate (CID 22673484) is [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate.
What is the SMILES notation for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate?
The canonical SMILES for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate is CCC(c1ccc(O)cc1)C(O)(O)c1c(O)cccc1OP(=O)(O)O.
What is the InChIKey of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate?
The InChIKey is APRPEKSZBFWZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19O8P/c1-2-12(10-6-8-11(17)9-7-10)16(19,20)15-13(18)4-3-5-14(15)24-25(21,22)23/h3-9,12,17-20H,2H2,1H3,(H2,21,22,23).
What are the key properties of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate?
[2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate has a molecular weight of 370.29 g/mol, XLogP of 1.90, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)butyl]-3-hydroxyphenyl] dihydrogen phosphate is sourced from PubChem (CID 22673484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).