C16H20NO5P — CID 57144956
[5-hydroxy-2-[2-(3-hydroxyphenyl)butyl]anilino]phosphonic acid (PubChem CID 57144956) has the molecular formula C16H20NO5P and a molecular weight of 337.31 g/mol. Its IUPAC name is [5-hydroxy-2-[2-(3-hydroxyphenyl)butyl]anilino]phosphonic acid.
| Compound Name | [5-hydroxy-2-[2-(3-hydroxyphenyl)butyl]anilino]phosphonic acid |
|---|---|
| PubChem CID | 57144956 |
| Molecular Formula | C16H20NO5P |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [5-hydroxy-2-[2-(3-hydroxyphenyl)butyl]anilino]phosphonic acid |
| SMILES | CCC(Cc1ccc(O)cc1NP(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H20NO5P/c1-2-11(12-4-3-5-14(18)9-12)8-13-6-7-15(19)10-16(13)17-23(20,21)22/h3-7,9-11,18-19H,2,8H2,1H3,(H3,17,20,21,22) |
| InChIKey | KBTQNWSHYJSZJP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|