C16H19O5P — CID 57282972
[3-hydroxy-2-[2-(3-hydroxyphenyl)butyl]phenyl]phosphonic acid (PubChem CID 57282972) has the molecular formula C16H19O5P and a molecular weight of 322.30 g/mol. Its IUPAC name is [3-hydroxy-2-[2-(3-hydroxyphenyl)butyl]phenyl]phosphonic acid.
| Compound Name | [3-hydroxy-2-[2-(3-hydroxyphenyl)butyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 57282972 |
| Molecular Formula | C16H19O5P |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [3-hydroxy-2-[2-(3-hydroxyphenyl)butyl]phenyl]phosphonic acid |
| SMILES | CCC(Cc1c(O)cccc1P(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H19O5P/c1-2-11(12-5-3-6-13(17)9-12)10-14-15(18)7-4-8-16(14)22(19,20)21/h3-9,11,17-18H,2,10H2,1H3,(H2,19,20,21) |
| InChIKey | ISNNYPGLRMPYCC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|