C15H16NO7P — CID 54173444
[3,5-dihydroxy-2-[2-(3-hydroxyphenyl)propanoyl]anilino]phosphonic acid (PubChem CID 54173444) has the molecular formula C15H16NO7P and a molecular weight of 353.27 g/mol. Its IUPAC name is [3,5-dihydroxy-2-[2-(3-hydroxyphenyl)propanoyl]anilino]phosphonic acid.
| Compound Name | [3,5-dihydroxy-2-[2-(3-hydroxyphenyl)propanoyl]anilino]phosphonic acid |
|---|---|
| PubChem CID | 54173444 |
| Molecular Formula | C15H16NO7P |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [3,5-dihydroxy-2-[2-(3-hydroxyphenyl)propanoyl]anilino]phosphonic acid |
| SMILES | CC(C(=O)c1c(O)cc(O)cc1NP(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H16NO7P/c1-8(9-3-2-4-10(17)5-9)15(20)14-12(16-24(21,22)23)6-11(18)7-13(14)19/h2-8,17-19H,1H3,(H3,16,21,22,23) |
| InChIKey | OWPNXXPYPPMHMP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|