C16H18O3 — CID 150256890
2-(4-hydroxyphenyl)-1-phenylbutane-1,1-diol (PubChem CID 150256890) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1-phenylbutane-1,1-diol.
| Compound Name | 2-(4-hydroxyphenyl)-1-phenylbutane-1,1-diol |
|---|---|
| PubChem CID | 150256890 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1-phenylbutane-1,1-diol |
| SMILES | CCC(c1ccc(O)cc1)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-2-15(12-8-10-14(17)11-9-12)16(18,19)13-6-4-3-5-7-13/h3-11,15,17-19H,2H2,1H3 |
| InChIKey | GASZMNYSLMJIAT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|