C24H26O4 — CID 174729195
2,2-bis(4-hydroxyphenyl)-3-phenylhexane-1,3-diol (PubChem CID 174729195) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2,2-bis(4-hydroxyphenyl)-3-phenylhexane-1,3-diol.
| Compound Name | 2,2-bis(4-hydroxyphenyl)-3-phenylhexane-1,3-diol |
|---|---|
| PubChem CID | 174729195 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2,2-bis(4-hydroxyphenyl)-3-phenylhexane-1,3-diol |
| SMILES | CCCC(O)(c1ccccc1)C(CO)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H26O4/c1-2-16-24(28,20-6-4-3-5-7-20)23(17-25,18-8-12-21(26)13-9-18)19-10-14-22(27)15-11-19/h3-15,25-28H,2,16-17H2,1H3 |
| InChIKey | RYZDATFPMHCFTM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |