C13H20O2 — CID 135018843
4,4-dimethyl-3-phenylpentane-1,3-diol (PubChem CID 135018843) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4,4-dimethyl-3-phenylpentane-1,3-diol.
| Compound Name | 4,4-dimethyl-3-phenylpentane-1,3-diol |
|---|---|
| PubChem CID | 135018843 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4,4-dimethyl-3-phenylpentane-1,3-diol |
| SMILES | CC(C)(C)C(O)(CCO)c1ccccc1 |
| InChI | InChI=1S/C13H20O2/c1-12(2,3)13(15,9-10-14)11-7-5-4-6-8-11/h4-8,14-15H,9-10H2,1-3H3 |
| InChIKey | URKPVQSMUPZRSV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |