C16H26ClNO — CID 11972143
3,3-dimethyl-2-phenyl-1-pyrrolidin-1-ylbutan-2-ol;hydrochloride (PubChem CID 11972143) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenyl-1-pyrrolidin-1-ylbutan-2-ol;hydrochloride.
| Compound Name | 3,3-dimethyl-2-phenyl-1-pyrrolidin-1-ylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 11972143 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3,3-dimethyl-2-phenyl-1-pyrrolidin-1-ylbutan-2-ol;hydrochloride |
| SMILES | CC(C)(C)C(O)(CN1CCCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H25NO.ClH/c1-15(2,3)16(18,13-17-11-7-8-12-17)14-9-5-4-6-10-14;/h4-6,9-10,18H,7-8,11-13H2,1-3H3;1H |
| InChIKey | AXTYPZNJLGPKNY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |