C21H28ClNO — CID 3060750
3-methyl-1,1-diphenyl-4-pyrrolidin-1-ylbutan-1-ol;hydrochloride (PubChem CID 3060750) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is 3-methyl-1,1-diphenyl-4-pyrrolidin-1-ylbutan-1-ol;hydrochloride.
| Compound Name | 3-methyl-1,1-diphenyl-4-pyrrolidin-1-ylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 3060750 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-methyl-1,1-diphenyl-4-pyrrolidin-1-ylbutan-1-ol;hydrochloride |
| SMILES | CC(CN1CCCC1)CC(O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-18(17-22-14-8-9-15-22)16-21(23,19-10-4-2-5-11-19)20-12-6-3-7-13-20;/h2-7,10-13,18,23H,8-9,14-17H2,1H3;1H |
| InChIKey | UAWPTSFXMQTSCA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |