C22H29NO — CID 29184942
(2S,3R)-2,3-diphenyl-1-piperidin-1-ylpentan-3-ol (PubChem CID 29184942) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (2S,3R)-2,3-diphenyl-1-piperidin-1-ylpentan-3-ol.
| Compound Name | (2S,3R)-2,3-diphenyl-1-piperidin-1-ylpentan-3-ol |
|---|---|
| PubChem CID | 29184942 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2S,3R)-2,3-diphenyl-1-piperidin-1-ylpentan-3-ol |
| SMILES | CC[C@](O)(c1ccccc1)[C@H](CN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO/c1-2-22(24,20-14-8-4-9-15-20)21(19-12-6-3-7-13-19)18-23-16-10-5-11-17-23/h3-4,6-9,12-15,21,24H,2,5,10-11,16-18H2,1H3/t21-,22+/m1/s1 |
| InChIKey | BPHKQTGRJWZBDM-YADHBBJMSA-N |
| XLogP | 4.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |