C22H29NO3 — CID 28949321
(2R,3R)-3-(4-methoxyphenyl)-1-morpholin-4-yl-2-phenylpentan-3-ol (PubChem CID 28949321) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R,3R)-3-(4-methoxyphenyl)-1-morpholin-4-yl-2-phenylpentan-3-ol.
| Compound Name | (2R,3R)-3-(4-methoxyphenyl)-1-morpholin-4-yl-2-phenylpentan-3-ol |
|---|---|
| PubChem CID | 28949321 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2R,3R)-3-(4-methoxyphenyl)-1-morpholin-4-yl-2-phenylpentan-3-ol |
| SMILES | CC[C@](O)(c1ccc(OC)cc1)[C@@H](CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3/c1-3-22(24,19-9-11-20(25-2)12-10-19)21(18-7-5-4-6-8-18)17-23-13-15-26-16-14-23/h4-12,21,24H,3,13-17H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | IZGQZUSXMGTWGK-VXKWHMMOSA-N |
| XLogP | 3.41 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |