C27H32ClNO3 — CID 146051967
2-(4-methoxyphenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol;hydrochloride (PubChem CID 146051967) has the molecular formula C27H32ClNO3 and a molecular weight of 454.01 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 146051967 |
| Molecular Formula | C27H32ClNO3 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol;hydrochloride |
| SMILES | COc1ccc(C(O)(Cc2ccccc2)C(CN2CCOCC2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H31NO3.ClH/c1-30-25-14-12-24(13-15-25)27(29,20-22-8-4-2-5-9-22)26(23-10-6-3-7-11-23)21-28-16-18-31-19-17-28;/h2-15,26,29H,16-21H2,1H3;1H |
| InChIKey | SIUPVVPIYJRKBG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |