C26H35NO3 — CID 28949434
(1S,2R)-1-cyclohexyl-1-(4-methoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol (PubChem CID 28949434) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyl-1-(4-methoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol.
| Compound Name | (1S,2R)-1-cyclohexyl-1-(4-methoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 28949434 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (1S,2R)-1-cyclohexyl-1-(4-methoxyphenyl)-3-morpholin-4-yl-2-phenylpropan-1-ol |
| SMILES | COc1ccc([C@](O)(C2CCCCC2)[C@@H](CN2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H35NO3/c1-29-24-14-12-23(13-15-24)26(28,22-10-6-3-7-11-22)25(21-8-4-2-5-9-21)20-27-16-18-30-19-17-27/h2,4-5,8-9,12-15,22,25,28H,3,6-7,10-11,16-20H2,1H3/t25-,26+/m0/s1 |
| InChIKey | VHZOBNQFBZAHNB-IZZNHLLZSA-N |
| XLogP | 4.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |