C25H32BrNO2 — CID 92720766
(1R,2R)-1-(4-bromophenyl)-1-cyclohexyl-3-morpholin-4-yl-2-phenylpropan-1-ol (PubChem CID 92720766) has the molecular formula C25H32BrNO2 and a molecular weight of 458.44 g/mol. Its IUPAC name is (1R,2R)-1-(4-bromophenyl)-1-cyclohexyl-3-morpholin-4-yl-2-phenylpropan-1-ol.
| Compound Name | (1R,2R)-1-(4-bromophenyl)-1-cyclohexyl-3-morpholin-4-yl-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 92720766 |
| Molecular Formula | C25H32BrNO2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (1R,2R)-1-(4-bromophenyl)-1-cyclohexyl-3-morpholin-4-yl-2-phenylpropan-1-ol |
| SMILES | O[C@](c1ccc(Br)cc1)(C1CCCCC1)[C@@H](CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C25H32BrNO2/c26-23-13-11-22(12-14-23)25(28,21-9-5-2-6-10-21)24(20-7-3-1-4-8-20)19-27-15-17-29-18-16-27/h1,3-4,7-8,11-14,21,24,28H,2,5-6,9-10,15-19H2/t24-,25-/m0/s1 |
| InChIKey | MKCWNMODGUNHIW-DQEYMECFSA-N |
| XLogP | 5.33 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |