C26H28FNO2 — CID 1116989
(2S,3R)-2-(4-fluorophenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol (PubChem CID 1116989) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (2S,3R)-2-(4-fluorophenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol.
| Compound Name | (2S,3R)-2-(4-fluorophenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 1116989 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (2S,3R)-2-(4-fluorophenyl)-4-morpholin-4-yl-1,3-diphenylbutan-2-ol |
| SMILES | O[C@](Cc1ccccc1)(c1ccc(F)cc1)[C@@H](CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H28FNO2/c27-24-13-11-23(12-14-24)26(29,19-21-7-3-1-4-8-21)25(22-9-5-2-6-10-22)20-28-15-17-30-18-16-28/h1-14,25,29H,15-20H2/t25-,26+/m0/s1 |
| InChIKey | WVRPUXZKFNELFC-IZZNHLLZSA-N |
| XLogP | 4.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |