C24H33NO2 — CID 92716985
(2R,3S)-3-(4-methoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol (PubChem CID 92716985) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (2R,3S)-3-(4-methoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol.
| Compound Name | (2R,3S)-3-(4-methoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol |
|---|---|
| PubChem CID | 92716985 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (2R,3S)-3-(4-methoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol |
| SMILES | COc1ccc([C@](O)(CC(C)C)[C@@H](CN2CCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-19(2)17-24(26,21-11-13-22(27-3)14-12-21)23(18-25-15-7-8-16-25)20-9-5-4-6-10-20/h4-6,9-14,19,23,26H,7-8,15-18H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | DIYLIMPGTSFMFT-BJKOFHAPSA-N |
| XLogP | 4.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |