C24H32ClNO3 — CID 23606587
2-(4-chlorophenyl)-3-(4-methoxyphenyl)-5-methyl-1-morpholin-4-ylhexan-3-ol (PubChem CID 23606587) has the molecular formula C24H32ClNO3 and a molecular weight of 417.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-5-methyl-1-morpholin-4-ylhexan-3-ol.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-5-methyl-1-morpholin-4-ylhexan-3-ol |
|---|---|
| PubChem CID | 23606587 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-5-methyl-1-morpholin-4-ylhexan-3-ol |
| SMILES | COc1ccc(C(O)(CC(C)C)C(CN2CCOCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H32ClNO3/c1-18(2)16-24(27,20-6-10-22(28-3)11-7-20)23(17-26-12-14-29-15-13-26)19-4-8-21(25)9-5-19/h4-11,18,23,27H,12-17H2,1-3H3 |
| InChIKey | MDDIGKZIVUQBLA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |