C21H26ClNO3 — CID 42563522
(2S,3R)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)-4-morpholin-4-ylbutan-2-ol (PubChem CID 42563522) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is (2S,3R)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)-4-morpholin-4-ylbutan-2-ol.
| Compound Name | (2S,3R)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)-4-morpholin-4-ylbutan-2-ol |
|---|---|
| PubChem CID | 42563522 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2S,3R)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)-4-morpholin-4-ylbutan-2-ol |
| SMILES | COc1ccc([C@@](C)(O)[C@@H](CN2CCOCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H26ClNO3/c1-21(24,17-5-9-19(25-2)10-6-17)20(15-23-11-13-26-14-12-23)16-3-7-18(22)8-4-16/h3-10,20,24H,11-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | XTBFRNVBMLNREL-LEWJYISDSA-N |
| XLogP | 3.67 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |