C23H30ClNO3 — CID 23606585
2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-1-morpholin-4-ylpentan-3-ol (PubChem CID 23606585) has the molecular formula C23H30ClNO3 and a molecular weight of 403.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-1-morpholin-4-ylpentan-3-ol.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-1-morpholin-4-ylpentan-3-ol |
|---|---|
| PubChem CID | 23606585 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-1-morpholin-4-ylpentan-3-ol |
| SMILES | COc1ccc(C(O)(C(C)C)C(CN2CCOCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H30ClNO3/c1-17(2)23(26,19-6-10-21(27-3)11-7-19)22(16-25-12-14-28-15-13-25)18-4-8-20(24)9-5-18/h4-11,17,22,26H,12-16H2,1-3H3 |
| InChIKey | CZTTXQZGPVVVHN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |