C25H35NO3 — CID 28949400
(2S,3R)-3-(4-methoxyphenyl)-6-methyl-1-morpholin-4-yl-2-phenylheptan-3-ol (PubChem CID 28949400) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S,3R)-3-(4-methoxyphenyl)-6-methyl-1-morpholin-4-yl-2-phenylheptan-3-ol.
| Compound Name | (2S,3R)-3-(4-methoxyphenyl)-6-methyl-1-morpholin-4-yl-2-phenylheptan-3-ol |
|---|---|
| PubChem CID | 28949400 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S,3R)-3-(4-methoxyphenyl)-6-methyl-1-morpholin-4-yl-2-phenylheptan-3-ol |
| SMILES | COc1ccc([C@@](O)(CCC(C)C)[C@H](CN2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-20(2)13-14-25(27,22-9-11-23(28-3)12-10-22)24(21-7-5-4-6-8-21)19-26-15-17-29-18-16-26/h4-12,20,24,27H,13-19H2,1-3H3/t24-,25+/m1/s1 |
| InChIKey | YTUJAJLUZJTQQQ-RPBOFIJWSA-N |
| XLogP | 4.43 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |