C26H38ClNO2 — CID 146052045
3-(4-methoxyphenyl)-6-methyl-2-phenyl-1-piperidin-1-ylheptan-3-ol;hydrochloride (PubChem CID 146052045) has the molecular formula C26H38ClNO2 and a molecular weight of 432.05 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6-methyl-2-phenyl-1-piperidin-1-ylheptan-3-ol;hydrochloride.
| Compound Name | 3-(4-methoxyphenyl)-6-methyl-2-phenyl-1-piperidin-1-ylheptan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 146052045 |
| Molecular Formula | C26H38ClNO2 |
| Molecular Weight | 432.05 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 3-(4-methoxyphenyl)-6-methyl-2-phenyl-1-piperidin-1-ylheptan-3-ol;hydrochloride |
| SMILES | COc1ccc(C(O)(CCC(C)C)C(CN2CCCCC2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C26H37NO2.ClH/c1-21(2)16-17-26(28,23-12-14-24(29-3)15-13-23)25(22-10-6-4-7-11-22)20-27-18-8-5-9-19-27;/h4,6-7,10-15,21,25,28H,5,8-9,16-20H2,1-3H3;1H |
| InChIKey | CINYIDIRZUHMDD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.05 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |