C25H35NO2 — CID 40643810
(2R,3S)-3-(4-ethoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol (PubChem CID 40643810) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (2R,3S)-3-(4-ethoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol.
| Compound Name | (2R,3S)-3-(4-ethoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol |
|---|---|
| PubChem CID | 40643810 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (2R,3S)-3-(4-ethoxyphenyl)-5-methyl-2-phenyl-1-pyrrolidin-1-ylhexan-3-ol |
| SMILES | CCOc1ccc([C@](O)(CC(C)C)[C@@H](CN2CCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35NO2/c1-4-28-23-14-12-22(13-15-23)25(27,18-20(2)3)24(19-26-16-8-9-17-26)21-10-6-5-7-11-21/h5-7,10-15,20,24,27H,4,8-9,16-19H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | XDCNZAPXVYVKTL-LOSJGSFVSA-N |
| XLogP | 5.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |