C28H41NO2 — CID 40643762
(2R,3S)-1-(azepan-1-yl)-3-(4-ethoxyphenyl)-6-methyl-2-phenylheptan-3-ol (PubChem CID 40643762) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is (2R,3S)-1-(azepan-1-yl)-3-(4-ethoxyphenyl)-6-methyl-2-phenylheptan-3-ol.
| Compound Name | (2R,3S)-1-(azepan-1-yl)-3-(4-ethoxyphenyl)-6-methyl-2-phenylheptan-3-ol |
|---|---|
| PubChem CID | 40643762 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (2R,3S)-1-(azepan-1-yl)-3-(4-ethoxyphenyl)-6-methyl-2-phenylheptan-3-ol |
| SMILES | CCOc1ccc([C@](O)(CCC(C)C)[C@@H](CN2CCCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H41NO2/c1-4-31-26-16-14-25(15-17-26)28(30,19-18-23(2)3)27(24-12-8-7-9-13-24)22-29-20-10-5-6-11-21-29/h7-9,12-17,23,27,30H,4-6,10-11,18-22H2,1-3H3/t27-,28+/m0/s1 |
| InChIKey | MOJCLCZPZSWCOK-WUFINQPMSA-N |
| XLogP | 6.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |