C28H41NO2 — CID 98213589
(2R,3R)-3-(4-ethoxyphenyl)-2-phenyl-1-pyrrolidin-1-yldecan-3-ol (PubChem CID 98213589) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is (2R,3R)-3-(4-ethoxyphenyl)-2-phenyl-1-pyrrolidin-1-yldecan-3-ol.
| Compound Name | (2R,3R)-3-(4-ethoxyphenyl)-2-phenyl-1-pyrrolidin-1-yldecan-3-ol |
|---|---|
| PubChem CID | 98213589 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (2R,3R)-3-(4-ethoxyphenyl)-2-phenyl-1-pyrrolidin-1-yldecan-3-ol |
| SMILES | CCCCCCC[C@](O)(c1ccc(OCC)cc1)[C@@H](CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H41NO2/c1-3-5-6-7-11-20-28(30,25-16-18-26(19-17-25)31-4-2)27(23-29-21-12-13-22-29)24-14-9-8-10-15-24/h8-10,14-19,27,30H,3-7,11-13,20-23H2,1-2H3/t27-,28-/m0/s1 |
| InChIKey | HQVUKFVZXYJPFB-NSOVKSMOSA-N |
| XLogP | 6.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|