C27H40ClNO2 — CID 45128058
3-(4-ethylphenyl)-1-morpholin-4-yl-2-phenylnonan-3-ol;hydrochloride (PubChem CID 45128058) has the molecular formula C27H40ClNO2 and a molecular weight of 446.08 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1-morpholin-4-yl-2-phenylnonan-3-ol;hydrochloride.
| Compound Name | 3-(4-ethylphenyl)-1-morpholin-4-yl-2-phenylnonan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 45128058 |
| Molecular Formula | C27H40ClNO2 |
| Molecular Weight | 446.08 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 3-(4-ethylphenyl)-1-morpholin-4-yl-2-phenylnonan-3-ol;hydrochloride |
| SMILES | CCCCCCC(O)(c1ccc(CC)cc1)C(CN1CCOCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C27H39NO2.ClH/c1-3-5-6-10-17-27(29,25-15-13-23(4-2)14-16-25)26(24-11-8-7-9-12-24)22-28-18-20-30-21-19-28;/h7-9,11-16,26,29H,3-6,10,17-22H2,1-2H3;1H |
| InChIKey | PZQYCBSGFDHFSV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|