C26H37NO3 — CID 92697716
(2R,3R)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenylhexan-3-ol (PubChem CID 92697716) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (2R,3R)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenylhexan-3-ol.
| Compound Name | (2R,3R)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenylhexan-3-ol |
|---|---|
| PubChem CID | 92697716 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (2R,3R)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenylhexan-3-ol |
| SMILES | CCCCOc1ccc([C@@](O)(CCC)[C@@H](CN2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H37NO3/c1-3-5-18-30-24-13-11-23(12-14-24)26(28,15-4-2)25(22-9-7-6-8-10-22)21-27-16-19-29-20-17-27/h6-14,25,28H,3-5,15-21H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | DIBAFDMSKKHAMC-UIOOFZCWSA-N |
| XLogP | 4.97 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|