C25H35NO3 — CID 26873941
(2S,3R)-4-morpholin-4-yl-2-(4-pentoxyphenyl)-3-phenylbutan-2-ol (PubChem CID 26873941) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S,3R)-4-morpholin-4-yl-2-(4-pentoxyphenyl)-3-phenylbutan-2-ol.
| Compound Name | (2S,3R)-4-morpholin-4-yl-2-(4-pentoxyphenyl)-3-phenylbutan-2-ol |
|---|---|
| PubChem CID | 26873941 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S,3R)-4-morpholin-4-yl-2-(4-pentoxyphenyl)-3-phenylbutan-2-ol |
| SMILES | CCCCCOc1ccc([C@@](C)(O)[C@@H](CN2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35NO3/c1-3-4-8-17-29-23-13-11-22(12-14-23)25(2,27)24(21-9-6-5-7-10-21)20-26-15-18-28-19-16-26/h5-7,9-14,24,27H,3-4,8,15-20H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | PATRGQJCCXOKSK-LOSJGSFVSA-N |
| XLogP | 4.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|