C30H45NO3 — CID 98214159
(2R,3S)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenyldecan-3-ol (PubChem CID 98214159) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is (2R,3S)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenyldecan-3-ol.
| Compound Name | (2R,3S)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenyldecan-3-ol |
|---|---|
| PubChem CID | 98214159 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | (2R,3S)-3-(4-butoxyphenyl)-1-morpholin-4-yl-2-phenyldecan-3-ol |
| SMILES | CCCCCCC[C@@](O)(c1ccc(OCCCC)cc1)[C@@H](CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C30H45NO3/c1-3-5-7-8-12-19-30(32,27-15-17-28(18-16-27)34-22-6-4-2)29(26-13-10-9-11-14-26)25-31-20-23-33-24-21-31/h9-11,13-18,29,32H,3-8,12,19-25H2,1-2H3/t29-,30+/m0/s1 |
| InChIKey | ODJUKBIHLUMBFK-XZWHSSHBSA-N |
| XLogP | 6.53 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|