C25H34ClNO3 — CID 28952674
(2R,3S)-2-(4-chlorophenyl)-3-(4-ethoxyphenyl)-1-morpholin-4-ylheptan-3-ol (PubChem CID 28952674) has the molecular formula C25H34ClNO3 and a molecular weight of 432.00 g/mol. Its IUPAC name is (2R,3S)-2-(4-chlorophenyl)-3-(4-ethoxyphenyl)-1-morpholin-4-ylheptan-3-ol.
| Compound Name | (2R,3S)-2-(4-chlorophenyl)-3-(4-ethoxyphenyl)-1-morpholin-4-ylheptan-3-ol |
|---|---|
| PubChem CID | 28952674 |
| Molecular Formula | C25H34ClNO3 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2R,3S)-2-(4-chlorophenyl)-3-(4-ethoxyphenyl)-1-morpholin-4-ylheptan-3-ol |
| SMILES | CCCC[C@@](O)(c1ccc(OCC)cc1)[C@@H](CN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H34ClNO3/c1-3-5-14-25(28,21-8-12-23(13-9-21)30-4-2)24(19-27-15-17-29-18-16-27)20-6-10-22(26)11-7-20/h6-13,24,28H,3-5,14-19H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | XMOALVBFZYUAEM-LOSJGSFVSA-N |
| XLogP | 5.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |