C22H29Cl2NO3 — CID 146051994
2-(4-chlorophenyl)-3-(4-methoxyphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride (PubChem CID 146051994) has the molecular formula C22H29Cl2NO3 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 146051994 |
| Molecular Formula | C22H29Cl2NO3 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride |
| SMILES | CCC(O)(c1ccc(OC)cc1)C(CN1CCOCC1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C22H28ClNO3.ClH/c1-3-22(25,18-6-10-20(26-2)11-7-18)21(16-24-12-14-27-15-13-24)17-4-8-19(23)9-5-17;/h4-11,21,25H,3,12-16H2,1-2H3;1H |
| InChIKey | JZNVTKMQKJVMOL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |