C24H32ClNO2 — CID 29184797
(2R,3R)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1-morpholin-4-ylhexan-3-ol (PubChem CID 29184797) has the molecular formula C24H32ClNO2 and a molecular weight of 401.98 g/mol. Its IUPAC name is (2R,3R)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1-morpholin-4-ylhexan-3-ol.
| Compound Name | (2R,3R)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1-morpholin-4-ylhexan-3-ol |
|---|---|
| PubChem CID | 29184797 |
| Molecular Formula | C24H32ClNO2 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2R,3R)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1-morpholin-4-ylhexan-3-ol |
| SMILES | CCC[C@](O)(c1ccc(CC)cc1)[C@@H](CN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClNO2/c1-3-13-24(27,21-9-5-19(4-2)6-10-21)23(18-26-14-16-28-17-15-26)20-7-11-22(25)12-8-20/h5-12,23,27H,3-4,13-18H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | YDUPEQQCLPGGEM-ZEQRLZLVSA-N |
| XLogP | 5.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |