C28H32ClNO3 — CID 23606863
2-(4-chlorophenyl)-1-(4-ethylphenyl)-1-(2-methoxyphenyl)-3-morpholin-4-ylpropan-1-ol (PubChem CID 23606863) has the molecular formula C28H32ClNO3 and a molecular weight of 466.02 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(4-ethylphenyl)-1-(2-methoxyphenyl)-3-morpholin-4-ylpropan-1-ol.
| Compound Name | 2-(4-chlorophenyl)-1-(4-ethylphenyl)-1-(2-methoxyphenyl)-3-morpholin-4-ylpropan-1-ol |
|---|---|
| PubChem CID | 23606863 |
| Molecular Formula | C28H32ClNO3 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(4-ethylphenyl)-1-(2-methoxyphenyl)-3-morpholin-4-ylpropan-1-ol |
| SMILES | CCc1ccc(C(O)(c2ccccc2OC)C(CN2CCOCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H32ClNO3/c1-3-21-8-12-23(13-9-21)28(31,25-6-4-5-7-27(25)32-2)26(20-30-16-18-33-19-17-30)22-10-14-24(29)15-11-22/h4-15,26,31H,3,16-20H2,1-2H3 |
| InChIKey | OQGQDVGDTWHHEJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |