C23H31Cl2NO2 — CID 146052076
2-(4-chlorophenyl)-4-methyl-3-(4-methylphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride (PubChem CID 146052076) has the molecular formula C23H31Cl2NO2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-methyl-3-(4-methylphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-4-methyl-3-(4-methylphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 146052076 |
| Molecular Formula | C23H31Cl2NO2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(4-chlorophenyl)-4-methyl-3-(4-methylphenyl)-1-morpholin-4-ylpentan-3-ol;hydrochloride |
| SMILES | Cc1ccc(C(O)(C(C)C)C(CN2CCOCC2)c2ccc(Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C23H30ClNO2.ClH/c1-17(2)23(26,20-8-4-18(3)5-9-20)22(16-25-12-14-27-15-13-25)19-6-10-21(24)11-7-19;/h4-11,17,22,26H,12-16H2,1-3H3;1H |
| InChIKey | KXVJQVOMFKCZKT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |