C24H32N2 — CID 3030528
5-methyl-4,4-diphenyl-6-piperidin-1-ylhexan-3-imine (PubChem CID 3030528) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 5-methyl-4,4-diphenyl-6-piperidin-1-ylhexan-3-imine.
| Compound Name | 5-methyl-4,4-diphenyl-6-piperidin-1-ylhexan-3-imine |
|---|---|
| PubChem CID | 3030528 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 5-methyl-4,4-diphenyl-6-piperidin-1-ylhexan-3-imine |
| SMILES | [H]/N=C(\CC)C(c1ccccc1)(c1ccccc1)C(C)CN1CCCCC1 |
| InChI | InChI=1S/C24H32N2/c1-3-23(25)24(21-13-7-4-8-14-21,22-15-9-5-10-16-22)20(2)19-26-17-11-6-12-18-26/h4-5,7-10,13-16,20,25H,3,6,11-12,17-19H2,1-2H3/b25-23+ |
| InChIKey | SDINSNRYAIPOQI-WJTDDFOZSA-N |
| XLogP | 5.52 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|