C26H38N2O2 — CID 167979498
1-[4-(2-hydroxy-3-methyl-2-phenylbutyl)piperazin-1-yl]-3-methyl-2-phenylbutan-2-ol (PubChem CID 167979498) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-3-methyl-2-phenylbutyl)piperazin-1-yl]-3-methyl-2-phenylbutan-2-ol.
| Compound Name | 1-[4-(2-hydroxy-3-methyl-2-phenylbutyl)piperazin-1-yl]-3-methyl-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 167979498 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 1-[4-(2-hydroxy-3-methyl-2-phenylbutyl)piperazin-1-yl]-3-methyl-2-phenylbutan-2-ol |
| SMILES | CC(C)C(O)(CN1CCN(CC(O)(c2ccccc2)C(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H38N2O2/c1-21(2)25(29,23-11-7-5-8-12-23)19-27-15-17-28(18-16-27)20-26(30,22(3)4)24-13-9-6-10-14-24/h5-14,21-22,29-30H,15-20H2,1-4H3 |
| InChIKey | ZTRFLDLYXSBJSY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |