C20H26O2 — CID 102025625
3,4-dimethyl-3,4-diphenylhexane-1,6-diol (PubChem CID 102025625) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-diphenylhexane-1,6-diol.
| Compound Name | 3,4-dimethyl-3,4-diphenylhexane-1,6-diol |
|---|---|
| PubChem CID | 102025625 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3,4-dimethyl-3,4-diphenylhexane-1,6-diol |
| SMILES | CC(CCO)(c1ccccc1)C(C)(CCO)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-19(13-15-21,17-9-5-3-6-10-17)20(2,14-16-22)18-11-7-4-8-12-18/h3-12,21-22H,13-16H2,1-2H3 |
| InChIKey | ZOARRIZBJFLGJC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |